C19H16N4O4S — CID 92801404
4-(1,3-dioxoisoindol-2-yl)-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]butanamide (PubChem CID 92801404) has the molecular formula C19H16N4O4S and a molecular weight of 396.43 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]butanamide |
|---|---|
| PubChem CID | 92801404 |
| Molecular Formula | C19H16N4O4S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)NCc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C19H16N4O4S/c24-15(20-11-16-21-17(22-27-16)14-7-4-10-28-14)8-3-9-23-18(25)12-5-1-2-6-13(12)19(23)26/h1-2,4-7,10H,3,8-9,11H2,(H,20,24) |
| InChIKey | DTVATYPURIZUKP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|