C21H19N3O3S2 — CID 90546874
4-(1,3-dioxoisoindol-2-yl)-N-[(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methyl]butanamide (PubChem CID 90546874) has the molecular formula C21H19N3O3S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methyl]butanamide |
|---|---|
| PubChem CID | 90546874 |
| Molecular Formula | C21H19N3O3S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methyl]butanamide |
| SMILES | Cc1nc(-c2cccs2)sc1CNC(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H19N3O3S2/c1-13-17(29-19(23-13)16-8-5-11-28-16)12-22-18(25)9-4-10-24-20(26)14-6-2-3-7-15(14)21(24)27/h2-3,5-8,11H,4,9-10,12H2,1H3,(H,22,25) |
| InChIKey | ZVWMMZLHMVKOGC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|