C17H16ClN3O2S2 — CID 50874930
4-(4-chlorophenyl)sulfanyl-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]butanamide (PubChem CID 50874930) has the molecular formula C17H16ClN3O2S2 and a molecular weight of 393.92 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]butanamide |
|---|---|
| PubChem CID | 50874930 |
| Molecular Formula | C17H16ClN3O2S2 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]butanamide |
| SMILES | O=C(CCCSc1ccc(Cl)cc1)NCc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C17H16ClN3O2S2/c18-12-5-7-13(8-6-12)24-9-2-4-15(22)19-11-16-20-17(21-23-16)14-3-1-10-25-14/h1,3,5-8,10H,2,4,9,11H2,(H,19,22) |
| InChIKey | PJLUQXOEXXMJLT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|