C15H11ClO4 — CID 883624
3-[(2-chloro-4-formylphenoxy)methyl]benzoic acid (PubChem CID 883624) has the molecular formula C15H11ClO4 and a molecular weight of 290.70 g/mol. Its IUPAC name is 3-[(2-chloro-4-formylphenoxy)methyl]benzoic acid.
| Compound Name | 3-[(2-chloro-4-formylphenoxy)methyl]benzoic acid |
|---|---|
| PubChem CID | 883624 |
| Molecular Formula | C15H11ClO4 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 3-[(2-chloro-4-formylphenoxy)methyl]benzoic acid |
| SMILES | O=Cc1ccc(OCc2cccc(C(=O)O)c2)c(Cl)c1 |
| InChI | InChI=1S/C15H11ClO4/c16-13-7-10(8-17)4-5-14(13)20-9-11-2-1-3-12(6-11)15(18)19/h1-8H,9H2,(H,18,19) |
| InChIKey | VXMPHQJQPBSBLV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|