C17H17ClO5S — CID 8836869
2-(4-chlorophenoxy)ethyl 3-(methylsulfonylmethyl)benzoate (PubChem CID 8836869) has the molecular formula C17H17ClO5S and a molecular weight of 368.84 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 3-(methylsulfonylmethyl)benzoate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 3-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 8836869 |
| Molecular Formula | C17H17ClO5S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 3-(methylsulfonylmethyl)benzoate |
| SMILES | CS(=O)(=O)Cc1cccc(C(=O)OCCOc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H17ClO5S/c1-24(20,21)12-13-3-2-4-14(11-13)17(19)23-10-9-22-16-7-5-15(18)6-8-16/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | SPTFCDVPCJQTCG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|