C19H22N2O6S — CID 8842159
[2-[2-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(benzenesulfonamido)acetate (PubChem CID 8842159) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is [2-[2-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(benzenesulfonamido)acetate.
| Compound Name | [2-[2-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(benzenesulfonamido)acetate |
|---|---|
| PubChem CID | 8842159 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [2-[2-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(benzenesulfonamido)acetate |
| SMILES | COc1ccccc1CCNC(=O)COC(=O)CNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O6S/c1-26-17-10-6-5-7-15(17)11-12-20-18(22)14-27-19(23)13-21-28(24,25)16-8-3-2-4-9-16/h2-10,21H,11-14H2,1H3,(H,20,22) |
| InChIKey | AKUNVLGLTHJDEA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |