C13H17ClN3O+ — CID 8843050
[2-(2-chloroanilino)-2-oxoethyl]-[(2S)-2-cyanopropyl]-methylazanium (PubChem CID 8843050) has the molecular formula C13H17ClN3O+ and a molecular weight of 266.75 g/mol. Its IUPAC name is [2-(2-chloroanilino)-2-oxoethyl]-[(2S)-2-cyanopropyl]-methylazanium.
| Compound Name | [2-(2-chloroanilino)-2-oxoethyl]-[(2S)-2-cyanopropyl]-methylazanium |
|---|---|
| PubChem CID | 8843050 |
| Molecular Formula | C13H17ClN3O+ |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | [2-(2-chloroanilino)-2-oxoethyl]-[(2S)-2-cyanopropyl]-methylazanium |
| SMILES | CC(C#N)C[NH+](C)CC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C13H16ClN3O/c1-10(7-15)8-17(2)9-13(18)16-12-6-4-3-5-11(12)14/h3-6,10H,8-9H2,1-2H3,(H,16,18)/p+1 |
| InChIKey | QENRUKGDFVPKIU-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |