C22H27NO4 — CID 8845558
[2-[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]-2-oxoethyl] 4-(hydroxymethyl)benzoate (PubChem CID 8845558) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]-2-oxoethyl] 4-(hydroxymethyl)benzoate.
| Compound Name | [2-[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]-2-oxoethyl] 4-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 8845558 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [2-[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]-2-oxoethyl] 4-(hydroxymethyl)benzoate |
| SMILES | CCc1ccc([C@H](NC(=O)COC(=O)c2ccc(CO)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C22H27NO4/c1-4-16-5-9-18(10-6-16)21(15(2)3)23-20(25)14-27-22(26)19-11-7-17(13-24)8-12-19/h5-12,15,21,24H,4,13-14H2,1-3H3,(H,23,25)/t21-/m1/s1 |
| InChIKey | JNTCDUAUUCDRKL-OAQYLSRUSA-N |
| XLogP | 3.41 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |