C13H11BrClNO4 — CID 8846348
[2-oxo-2-(prop-2-ynylamino)ethyl] 2-(2-bromo-4-chlorophenoxy)acetate (PubChem CID 8846348) has the molecular formula C13H11BrClNO4 and a molecular weight of 360.59 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 2-(2-bromo-4-chlorophenoxy)acetate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-(2-bromo-4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 8846348 |
| Molecular Formula | C13H11BrClNO4 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-(2-bromo-4-chlorophenoxy)acetate |
| SMILES | C#CCNC(=O)COC(=O)COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C13H11BrClNO4/c1-2-5-16-12(17)7-20-13(18)8-19-11-4-3-9(15)6-10(11)14/h1,3-4,6H,5,7-8H2,(H,16,17) |
| InChIKey | AJIYVVAORIIOPF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|