C15H16N4O2S — CID 885036
N-[2-(3,5-dimethylpyrazol-1-yl)quinolin-8-yl]methanesulfonamide (PubChem CID 885036) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpyrazol-1-yl)quinolin-8-yl]methanesulfonamide.
| Compound Name | N-[2-(3,5-dimethylpyrazol-1-yl)quinolin-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 885036 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-[2-(3,5-dimethylpyrazol-1-yl)quinolin-8-yl]methanesulfonamide |
| SMILES | Cc1cc(C)n(-c2ccc3cccc(NS(C)(=O)=O)c3n2)n1 |
| InChI | InChI=1S/C15H16N4O2S/c1-10-9-11(2)19(17-10)14-8-7-12-5-4-6-13(15(12)16-14)18-22(3,20)21/h4-9,18H,1-3H3 |
| InChIKey | YVJYHMAMNYGITG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |