C28H30N4O7S2 — CID 88503902
1-[2-[[(2S)-2-amino-3-[4-(sulfanylcarbonylamino)phenyl]propanoyl]amino]-2-naphthalen-2-ylsulfonylacetyl]piperidine-2-carboxylic acid (PubChem CID 88503902) has the molecular formula C28H30N4O7S2 and a molecular weight of 598.70 g/mol. Its IUPAC name is 1-[2-[[(2S)-2-amino-3-[4-(sulfanylcarbonylamino)phenyl]propanoyl]amino]-2-naphthalen-2-ylsulfonylacetyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-[[(2S)-2-amino-3-[4-(sulfanylcarbonylamino)phenyl]propanoyl]amino]-2-naphthalen-2-ylsulfonylacetyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88503902 |
| Molecular Formula | C28H30N4O7S2 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | 1-[2-[[(2S)-2-amino-3-[4-(sulfanylcarbonylamino)phenyl]propanoyl]amino]-2-naphthalen-2-ylsulfonylacetyl]piperidine-2-carboxylic acid |
| SMILES | N[C@@H](Cc1ccc(NC(=O)S)cc1)C(=O)NC(C(=O)N1CCCCC1C(=O)O)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H30N4O7S2/c29-22(15-17-8-11-20(12-9-17)30-28(37)40)24(33)31-25(26(34)32-14-4-3-7-23(32)27(35)36)41(38,39)21-13-10-18-5-1-2-6-19(18)16-21/h1-2,5-6,8-13,16,22-23,25H,3-4,7,14-15,29H2,(H,31,33)(H,35,36)(H2,30,37,40)/t22-,23?,25?/m0/s1 |
| InChIKey | KILBTSUDRILGHI-ICXLUZGWSA-N |
| XLogP | 2.55 |
| TPSA | 175.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|