C17H24BrN2O3+ — CID 8850511
(2-bromo-5-methoxyphenyl)-[4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]methanone (PubChem CID 8850511) has the molecular formula C17H24BrN2O3+ and a molecular weight of 384.29 g/mol. Its IUPAC name is (2-bromo-5-methoxyphenyl)-[4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]methanone.
| Compound Name | (2-bromo-5-methoxyphenyl)-[4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 8850511 |
| Molecular Formula | C17H24BrN2O3+ |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | (2-bromo-5-methoxyphenyl)-[4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]methanone |
| SMILES | COc1ccc(Br)c(C(=O)N2CC[NH+](C[C@@H]3CCCO3)CC2)c1 |
| InChI | InChI=1S/C17H23BrN2O3/c1-22-13-4-5-16(18)15(11-13)17(21)20-8-6-19(7-9-20)12-14-3-2-10-23-14/h4-5,11,14H,2-3,6-10,12H2,1H3/p+1/t14-/m0/s1 |
| InChIKey | WOQXWRAGODUJKV-AWEZNQCLSA-O |
| XLogP | 0.98 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |