C18H13F3N2O — CID 88507577
1-[[(2R,3S)-3-(2,6-difluorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]imidazole (PubChem CID 88507577) has the molecular formula C18H13F3N2O and a molecular weight of 330.31 g/mol. Its IUPAC name is 1-[[(2R,3S)-3-(2,6-difluorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]imidazole.
| Compound Name | 1-[[(2R,3S)-3-(2,6-difluorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]imidazole |
|---|---|
| PubChem CID | 88507577 |
| Molecular Formula | C18H13F3N2O |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-[[(2R,3S)-3-(2,6-difluorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]imidazole |
| SMILES | Fc1ccc([C@]2(Cn3ccnc3)O[C@H]2c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C18H13F3N2O/c19-13-6-4-12(5-7-13)18(10-23-9-8-22-11-23)17(24-18)16-14(20)2-1-3-15(16)21/h1-9,11,17H,10H2/t17-,18-/m0/s1 |
| InChIKey | OFRVGRPXZGMGNU-ROUUACIJSA-N |
| XLogP | 3.97 |
| TPSA | 30.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|