C12H10F2N2O — CID 22285361
1-[[2-(2,4-difluorophenyl)oxiran-2-yl]methyl]imidazole (PubChem CID 22285361) has the molecular formula C12H10F2N2O and a molecular weight of 236.22 g/mol. Its IUPAC name is 1-[[2-(2,4-difluorophenyl)oxiran-2-yl]methyl]imidazole.
| Compound Name | 1-[[2-(2,4-difluorophenyl)oxiran-2-yl]methyl]imidazole |
|---|---|
| PubChem CID | 22285361 |
| Molecular Formula | C12H10F2N2O |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-[[2-(2,4-difluorophenyl)oxiran-2-yl]methyl]imidazole |
| SMILES | Fc1ccc(C2(Cn3ccnc3)CO2)c(F)c1 |
| InChI | InChI=1S/C12H10F2N2O/c13-9-1-2-10(11(14)5-9)12(7-17-12)6-16-4-3-15-8-16/h1-5,8H,6-7H2 |
| InChIKey | ZLFKENRQURFQRT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 30.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|