C19H15ClF2N2O2 — CID 19913066
1-[2-(2-chlorophenyl)oxiran-2-yl]-1-(2,4-difluorophenyl)-2-imidazol-1-ylethanol (PubChem CID 19913066) has the molecular formula C19H15ClF2N2O2 and a molecular weight of 376.79 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)oxiran-2-yl]-1-(2,4-difluorophenyl)-2-imidazol-1-ylethanol.
| Compound Name | 1-[2-(2-chlorophenyl)oxiran-2-yl]-1-(2,4-difluorophenyl)-2-imidazol-1-ylethanol |
|---|---|
| PubChem CID | 19913066 |
| Molecular Formula | C19H15ClF2N2O2 |
| Molecular Weight | 376.79 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 1-[2-(2-chlorophenyl)oxiran-2-yl]-1-(2,4-difluorophenyl)-2-imidazol-1-ylethanol |
| SMILES | OC(Cn1ccnc1)(c1ccc(F)cc1F)C1(c2ccccc2Cl)CO1 |
| InChI | InChI=1S/C19H15ClF2N2O2/c20-16-4-2-1-3-14(16)19(11-26-19)18(25,10-24-8-7-23-12-24)15-6-5-13(21)9-17(15)22/h1-9,12,25H,10-11H2 |
| InChIKey | RBLAIEJDCJTBJY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.79 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|