About 2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride
2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride (PubChem CID 88507578) has the molecular formula C10H15ClFNO2S
and a molecular weight of 267.75 g/mol. Its IUPAC name is 2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride |
| PubChem CID | 88507578 |
| Molecular Formula | C10H15ClFNO2S |
| Molecular Weight | 267.75 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride |
| SMILES | CCc1ccc(NCCS(=O)(=O)F)cc1.Cl |
| InChI | InChI=1S/C10H14FNO2S.ClH/c1-2-9-3-5-10(6-4-9)12-7-8-15(11,13)14;/h3-6,12H,2,7-8H2,1H3;1H |
| InChIKey | VUPUKWRRCQXJMO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.75 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride?
The IUPAC name of 2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride (CID 88507578) is 2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride.
What is the SMILES notation for 2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride?
The canonical SMILES for 2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride is CCc1ccc(NCCS(=O)(=O)F)cc1.Cl.
What is the InChIKey of 2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride?
The InChIKey is VUPUKWRRCQXJMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FNO2S.ClH/c1-2-9-3-5-10(6-4-9)12-7-8-15(11,13)14;/h3-6,12H,2,7-8H2,1H3;1H.
What are the key properties of 2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride?
2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride has a molecular weight of 267.75 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylanilino)ethanesulfonyl fluoride;hydrochloride is sourced from PubChem (CID 88507578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).