C11H24N2O2 — CID 88513172
2-[2-hydroxyethyl-[(E)-3-(2-methylpropylamino)prop-1-enyl]amino]ethanol (PubChem CID 88513172) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[(E)-3-(2-methylpropylamino)prop-1-enyl]amino]ethanol.
| Compound Name | 2-[2-hydroxyethyl-[(E)-3-(2-methylpropylamino)prop-1-enyl]amino]ethanol |
|---|---|
| PubChem CID | 88513172 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 2-[2-hydroxyethyl-[(E)-3-(2-methylpropylamino)prop-1-enyl]amino]ethanol |
| SMILES | CC(C)CNC/C=C/N(CCO)CCO |
| InChI | InChI=1S/C11H24N2O2/c1-11(2)10-12-4-3-5-13(6-8-14)7-9-15/h3,5,11-12,14-15H,4,6-10H2,1-2H3/b5-3+ |
| InChIKey | MOCYECVUGJKLPF-HWKANZROSA-N |
| XLogP | 0.03 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|