C8H19N3O — CID 90451886
2-[[(Z)-3-amino-1-(methylamino)prop-2-enyl]-ethylamino]ethanol (PubChem CID 90451886) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-[[(Z)-3-amino-1-(methylamino)prop-2-enyl]-ethylamino]ethanol.
| Compound Name | 2-[[(Z)-3-amino-1-(methylamino)prop-2-enyl]-ethylamino]ethanol |
|---|---|
| PubChem CID | 90451886 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | 2-[[(Z)-3-amino-1-(methylamino)prop-2-enyl]-ethylamino]ethanol |
| SMILES | CCN(CCO)C(/C=C\N)NC |
| InChI | InChI=1S/C8H19N3O/c1-3-11(6-7-12)8(10-2)4-5-9/h4-5,8,10,12H,3,6-7,9H2,1-2H3/b5-4- |
| InChIKey | BEVXGQWIPVUIDO-PLNGDYQASA-N |
| XLogP | -0.68 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|