C10H22N2O3 — CID 87752769
N,N-bis(2-hydroxyethyl)-1-(prop-2-enylamino)propan-1-amine oxide (PubChem CID 87752769) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-1-(prop-2-enylamino)propan-1-amine oxide.
| Compound Name | N,N-bis(2-hydroxyethyl)-1-(prop-2-enylamino)propan-1-amine oxide |
|---|---|
| PubChem CID | 87752769 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-1-(prop-2-enylamino)propan-1-amine oxide |
| SMILES | C=CCNC(CC)[N+]([O-])(CCO)CCO |
| InChI | InChI=1S/C10H22N2O3/c1-3-5-11-10(4-2)12(15,6-8-13)7-9-14/h3,10-11,13-14H,1,4-9H2,2H3 |
| InChIKey | ZGERWWDVPZFQJK-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|