C14H31N3O5S — CID 87065196
2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium;methyl sulfate (PubChem CID 87065196) has the molecular formula C14H31N3O5S and a molecular weight of 353.49 g/mol. Its IUPAC name is 2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium;methyl sulfate.
| Compound Name | 2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium;methyl sulfate |
|---|---|
| PubChem CID | 87065196 |
| Molecular Formula | C14H31N3O5S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium;methyl sulfate |
| SMILES | C=CCNC(C)[N+](C)(CCO)C(C)NCC=C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C13H28N3O.CH4O4S/c1-6-8-14-12(3)16(5,10-11-17)13(4)15-9-7-2;1-5-6(2,3)4/h6-7,12-15,17H,1-2,8-11H2,3-5H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | UWGGZFGERLIQFU-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|