About 1-(2-methyl-2,6-dihydro-1H-pyrimidin-3-yl)ethanol
1-(2-methyl-2,6-dihydro-1H-pyrimidin-3-yl)ethanol (PubChem CID 21486751) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 1-(2-methyl-2,6-dihydro-1H-pyrimidin-3-yl)ethanol.
Analyze 1-(2-methyl-2,6-dihydro-1H-pyrimidin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methyl-2,6-dihydro-1H-pyrimidin-3-yl)ethanol?
The IUPAC name of 1-(2-methyl-2,6-dihydro-1H-pyrimidin-3-yl)ethanol (CID 21486751) is 1-(2-methyl-2,6-dihydro-1H-pyrimidin-3-yl)ethanol.
What is the SMILES notation for 1-(2-methyl-2,6-dihydro-1H-pyrimidin-3-yl)ethanol?
The canonical SMILES for 1-(2-methyl-2,6-dihydro-1H-pyrimidin-3-yl)ethanol is CC(O)N1C=CCNC1C.
What is the InChIKey of 1-(2-methyl-2,6-dihydro-1H-pyrimidin-3-yl)ethanol?
The InChIKey is KCHQZYGZTUSMKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-6-8-4-3-5-9(6)7(2)10/h3,5-8,10H,4H2,1-2H3.
What are the key properties of 1-(2-methyl-2,6-dihydro-1H-pyrimidin-3-yl)ethanol?
1-(2-methyl-2,6-dihydro-1H-pyrimidin-3-yl)ethanol has a molecular weight of 142.20 g/mol, XLogP of 0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methyl-2,6-dihydro-1H-pyrimidin-3-yl)ethanol is sourced from PubChem (CID 21486751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).