C26H20BF6N3 — CID 88515272
methyl-bis[3-(trifluoromethyl)phenyl]borane;2-(2-phenylimidazol-1-yl)acetonitrile (PubChem CID 88515272) has the molecular formula C26H20BF6N3 and a molecular weight of 499.27 g/mol. Its IUPAC name is methyl-bis[3-(trifluoromethyl)phenyl]borane;2-(2-phenylimidazol-1-yl)acetonitrile.
| Compound Name | methyl-bis[3-(trifluoromethyl)phenyl]borane;2-(2-phenylimidazol-1-yl)acetonitrile |
|---|---|
| PubChem CID | 88515272 |
| Molecular Formula | C26H20BF6N3 |
| Molecular Weight | 499.27 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | methyl-bis[3-(trifluoromethyl)phenyl]borane;2-(2-phenylimidazol-1-yl)acetonitrile |
| SMILES | CB(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1.N#CCn1ccnc1-c1ccccc1 |
| InChI | InChI=1S/C15H11BF6.C11H9N3/c1-16(12-6-2-4-10(8-12)14(17,18)19)13-7-3-5-11(9-13)15(20,21)22;12-6-8-14-9-7-13-11(14)10-4-2-1-3-5-10/h2-9H,1H3;1-5,7,9H,8H2 |
| InChIKey | QEOHMQJIRKYMNH-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.27 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|