C23H23F3N4O — CID 90494538
4-[(2-phenylimidazol-1-yl)methyl]-N-[3-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 90494538) has the molecular formula C23H23F3N4O and a molecular weight of 428.46 g/mol. Its IUPAC name is 4-[(2-phenylimidazol-1-yl)methyl]-N-[3-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-[(2-phenylimidazol-1-yl)methyl]-N-[3-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 90494538 |
| Molecular Formula | C23H23F3N4O |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 4-[(2-phenylimidazol-1-yl)methyl]-N-[3-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)N1CCC(Cn2ccnc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H23F3N4O/c24-23(25,26)19-7-4-8-20(15-19)28-22(31)29-12-9-17(10-13-29)16-30-14-11-27-21(30)18-5-2-1-3-6-18/h1-8,11,14-15,17H,9-10,12-13,16H2,(H,28,31) |
| InChIKey | NLGOGUAQAPKDPJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |