C38H82NO8P — CID 88516140
hexadecyl dihydrogen phosphate;2-(2-hydroxyethylamino)ethanol;octadecanoic acid (PubChem CID 88516140) has the molecular formula C38H82NO8P and a molecular weight of 712.05 g/mol. Its IUPAC name is hexadecyl dihydrogen phosphate;2-(2-hydroxyethylamino)ethanol;octadecanoic acid.
| Compound Name | hexadecyl dihydrogen phosphate;2-(2-hydroxyethylamino)ethanol;octadecanoic acid |
|---|---|
| PubChem CID | 88516140 |
| Molecular Formula | C38H82NO8P |
| Molecular Weight | 712.05 g/mol |
| Exact Mass | 711.58 |
| IUPAC Name | hexadecyl dihydrogen phosphate;2-(2-hydroxyethylamino)ethanol;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCCCCCCCOP(=O)(O)O.OCCNCCO |
| InChI | InChI=1S/C18H36O2.C16H35O4P.C4H11NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-21(17,18)19;6-3-1-5-2-4-7/h2-17H2,1H3,(H,19,20);2-16H2,1H3,(H2,17,18,19);5-7H,1-4H2 |
| InChIKey | JQOCDHYFGHZOKY-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.05 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|