C46H102N4O14 — CID 173173629
tetrakis(2-methoxy-N-(2-methoxyethyl)ethanamine);undecanedioic acid;undecanoic acid (PubChem CID 173173629) has the molecular formula C46H102N4O14 and a molecular weight of 935.34 g/mol. Its IUPAC name is tetrakis(2-methoxy-N-(2-methoxyethyl)ethanamine);undecanedioic acid;undecanoic acid.
| Compound Name | tetrakis(2-methoxy-N-(2-methoxyethyl)ethanamine);undecanedioic acid;undecanoic acid |
|---|---|
| PubChem CID | 173173629 |
| Molecular Formula | C46H102N4O14 |
| Molecular Weight | 935.34 g/mol |
| Exact Mass | 934.74 |
| IUPAC Name | tetrakis(2-methoxy-N-(2-methoxyethyl)ethanamine);undecanedioic acid;undecanoic acid |
| SMILES | CCCCCCCCCCC(=O)O.COCCNCCOC.COCCNCCOC.COCCNCCOC.COCCNCCOC.O=C(O)CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C11H20O4.C11H22O2.4C6H15NO2/c12-10(13)8-6-4-2-1-3-5-7-9-11(14)15;1-2-3-4-5-6-7-8-9-10-11(12)13;4*1-8-5-3-7-4-6-9-2/h1-9H2,(H,12,13)(H,14,15);2-10H2,1H3,(H,12,13);4*7H,3-6H2,1-2H3 |
| InChIKey | SBCFJYBUGHVTSV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 233.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 64 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.34 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|