C16H8Cl12 — CID 88520389
1,4-bis(trichloromethyl)benzene (PubChem CID 88520389) has the molecular formula C16H8Cl12 and a molecular weight of 625.68 g/mol. Its IUPAC name is 1,4-bis(trichloromethyl)benzene.
| Compound Name | 1,4-bis(trichloromethyl)benzene |
|---|---|
| PubChem CID | 88520389 |
| Molecular Formula | C16H8Cl12 |
| Molecular Weight | 625.68 g/mol |
| Exact Mass | 619.69 |
| IUPAC Name | 1,4-bis(trichloromethyl)benzene |
| SMILES | ClC(Cl)(Cl)c1ccc(C(Cl)(Cl)Cl)cc1.ClC(Cl)(Cl)c1ccc(C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/2C8H4Cl6/c2*9-7(10,11)5-1-2-6(4-3-5)8(12,13)14/h2*1-4H |
| InChIKey | JFYIHMKXJNDZPA-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.68 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|