C24H36N5O6+ — CID 88520782
[4-[[1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-benzyl-4-oxobutanoyl]-(2-methoxyethoxy)-(2-methoxyethyl)-methylazanium (PubChem CID 88520782) has the molecular formula C24H36N5O6+ and a molecular weight of 490.58 g/mol. Its IUPAC name is [4-[[1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-benzyl-4-oxobutanoyl]-(2-methoxyethoxy)-(2-methoxyethyl)-methylazanium.
| Compound Name | [4-[[1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-benzyl-4-oxobutanoyl]-(2-methoxyethoxy)-(2-methoxyethyl)-methylazanium |
|---|---|
| PubChem CID | 88520782 |
| Molecular Formula | C24H36N5O6+ |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | [4-[[1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-benzyl-4-oxobutanoyl]-(2-methoxyethoxy)-(2-methoxyethyl)-methylazanium |
| SMILES | COCCO[N+](C)(CCOC)C(=O)CC(Cc1ccccc1)C(=O)NC(Cc1cnc[nH]1)C(N)=O |
| InChI | InChI=1S/C24H35N5O6/c1-29(9-10-33-2,35-12-11-34-3)22(30)14-19(13-18-7-5-4-6-8-18)24(32)28-21(23(25)31)15-20-16-26-17-27-20/h4-8,16-17,19,21H,9-15H2,1-3H3,(H3-,25,26,27,28,31,32)/p+1 |
| InChIKey | MNESFDOZOGJOIV-UHFFFAOYSA-O |
| XLogP | 0.37 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|