C24H35N5O6 — CID 70044740
N-[1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-2-benzyl-N'-[2-(2-methoxyethoxymethoxy)ethyl]-N'-methylbutanediamide (PubChem CID 70044740) has the molecular formula C24H35N5O6 and a molecular weight of 489.57 g/mol. Its IUPAC name is N-[1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-2-benzyl-N'-[2-(2-methoxyethoxymethoxy)ethyl]-N'-methylbutanediamide.
| Compound Name | N-[1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-2-benzyl-N'-[2-(2-methoxyethoxymethoxy)ethyl]-N'-methylbutanediamide |
|---|---|
| PubChem CID | 70044740 |
| Molecular Formula | C24H35N5O6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | N-[1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-2-benzyl-N'-[2-(2-methoxyethoxymethoxy)ethyl]-N'-methylbutanediamide |
| SMILES | COCCOCOCCN(C)C(=O)CC(Cc1ccccc1)C(=O)NC(Cc1cnc[nH]1)C(N)=O |
| InChI | InChI=1S/C24H35N5O6/c1-29(8-9-34-17-35-11-10-33-2)22(30)13-19(12-18-6-4-3-5-7-18)24(32)28-21(23(25)31)14-20-15-26-16-27-20/h3-7,15-16,19,21H,8-14,17H2,1-2H3,(H2,25,31)(H,26,27)(H,28,32) |
| InChIKey | RLZBYKMSPNGCER-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 148.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|