C22H35NO6 — CID 54439717
benzyl (2R)-2-[2-[2-(2-methoxyethoxymethoxy)ethyl-methylamino]-2-oxoethyl]-4-methylpentanoate (PubChem CID 54439717) has the molecular formula C22H35NO6 and a molecular weight of 409.52 g/mol. Its IUPAC name is benzyl (2R)-2-[2-[2-(2-methoxyethoxymethoxy)ethyl-methylamino]-2-oxoethyl]-4-methylpentanoate.
| Compound Name | benzyl (2R)-2-[2-[2-(2-methoxyethoxymethoxy)ethyl-methylamino]-2-oxoethyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 54439717 |
| Molecular Formula | C22H35NO6 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | benzyl (2R)-2-[2-[2-(2-methoxyethoxymethoxy)ethyl-methylamino]-2-oxoethyl]-4-methylpentanoate |
| SMILES | COCCOCOCCN(C)C(=O)C[C@@H](CC(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H35NO6/c1-18(2)14-20(22(25)29-16-19-8-6-5-7-9-19)15-21(24)23(3)10-11-27-17-28-13-12-26-4/h5-9,18,20H,10-17H2,1-4H3/t20-/m1/s1 |
| InChIKey | WNFUUGSTDWSKDG-HXUWFJFHSA-N |
| XLogP | 2.88 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|