C22H27NO5 — CID 54369785
benzyl (2R)-2-benzyl-4-[2,3-dihydroxypropyl(methyl)amino]-4-oxobutanoate (PubChem CID 54369785) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is benzyl (2R)-2-benzyl-4-[2,3-dihydroxypropyl(methyl)amino]-4-oxobutanoate.
| Compound Name | benzyl (2R)-2-benzyl-4-[2,3-dihydroxypropyl(methyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 54369785 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | benzyl (2R)-2-benzyl-4-[2,3-dihydroxypropyl(methyl)amino]-4-oxobutanoate |
| SMILES | CN(CC(O)CO)C(=O)C[C@@H](Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H27NO5/c1-23(14-20(25)15-24)21(26)13-19(12-17-8-4-2-5-9-17)22(27)28-16-18-10-6-3-7-11-18/h2-11,19-20,24-25H,12-16H2,1H3/t19-,20?/m1/s1 |
| InChIKey | USIRCIRAUYLZTQ-FIWHBWSRSA-N |
| XLogP | 1.79 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |