C25H33NO6 — CID 15016683
benzyl (2R)-2-benzyl-4-[2-(2-methoxyethoxymethoxy)ethyl-methylamino]-4-oxobutanoate (PubChem CID 15016683) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is benzyl (2R)-2-benzyl-4-[2-(2-methoxyethoxymethoxy)ethyl-methylamino]-4-oxobutanoate.
| Compound Name | benzyl (2R)-2-benzyl-4-[2-(2-methoxyethoxymethoxy)ethyl-methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 15016683 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | benzyl (2R)-2-benzyl-4-[2-(2-methoxyethoxymethoxy)ethyl-methylamino]-4-oxobutanoate |
| SMILES | COCCOCOCCN(C)C(=O)C[C@@H](Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H33NO6/c1-26(13-14-30-20-31-16-15-29-2)24(27)18-23(17-21-9-5-3-6-10-21)25(28)32-19-22-11-7-4-8-12-22/h3-12,23H,13-20H2,1-2H3/t23-/m1/s1 |
| InChIKey | ANNVHVXHGDWWTI-HSZRJFAPSA-N |
| XLogP | 3.07 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|