C24H20F3NO4 — CID 88527769
1-[3-hydroxy-2,2-dimethyl-6-(3,4,5-trifluoro-2-methylbenzoyl)-3,4-dihydrochromen-4-yl]pyridin-2-one (PubChem CID 88527769) has the molecular formula C24H20F3NO4 and a molecular weight of 443.42 g/mol. Its IUPAC name is 1-[3-hydroxy-2,2-dimethyl-6-(3,4,5-trifluoro-2-methylbenzoyl)-3,4-dihydrochromen-4-yl]pyridin-2-one.
| Compound Name | 1-[3-hydroxy-2,2-dimethyl-6-(3,4,5-trifluoro-2-methylbenzoyl)-3,4-dihydrochromen-4-yl]pyridin-2-one |
|---|---|
| PubChem CID | 88527769 |
| Molecular Formula | C24H20F3NO4 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-[3-hydroxy-2,2-dimethyl-6-(3,4,5-trifluoro-2-methylbenzoyl)-3,4-dihydrochromen-4-yl]pyridin-2-one |
| SMILES | Cc1c(C(=O)c2ccc3c(c2)C(n2ccccc2=O)C(O)C(C)(C)O3)cc(F)c(F)c1F |
| InChI | InChI=1S/C24H20F3NO4/c1-12-14(11-16(25)20(27)19(12)26)22(30)13-7-8-17-15(10-13)21(23(31)24(2,3)32-17)28-9-5-4-6-18(28)29/h4-11,21,23,31H,1-3H3 |
| InChIKey | GNMVGVMJKUIBBA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|