C45H53N — CID 88530157
3-[5-[4-[4-(3-cyclohexa-1,3-dien-1-yl-5-cyclohex-2-en-1-ylphenyl)cyclohexen-1-yl]-2,3,7,8-tetrahydronaphthalen-1-yl]cyclohexa-2,4-dien-1-yl]piperidine (PubChem CID 88530157) has the molecular formula C45H53N and a molecular weight of 607.93 g/mol. Its IUPAC name is 3-[5-[4-[4-(3-cyclohexa-1,3-dien-1-yl-5-cyclohex-2-en-1-ylphenyl)cyclohexen-1-yl]-2,3,7,8-tetrahydronaphthalen-1-yl]cyclohexa-2,4-dien-1-yl]piperidine.
| Compound Name | 3-[5-[4-[4-(3-cyclohexa-1,3-dien-1-yl-5-cyclohex-2-en-1-ylphenyl)cyclohexen-1-yl]-2,3,7,8-tetrahydronaphthalen-1-yl]cyclohexa-2,4-dien-1-yl]piperidine |
|---|---|
| PubChem CID | 88530157 |
| Molecular Formula | C45H53N |
| Molecular Weight | 607.93 g/mol |
| Exact Mass | 607.42 |
| IUPAC Name | 3-[5-[4-[4-(3-cyclohexa-1,3-dien-1-yl-5-cyclohex-2-en-1-ylphenyl)cyclohexen-1-yl]-2,3,7,8-tetrahydronaphthalen-1-yl]cyclohexa-2,4-dien-1-yl]piperidine |
| SMILES | C1=CCCC(c2cc(C3C=CCCC3)cc(C3CC=C(C4=C5C=CCCC5=C(C5=CC=CC(C6CCCNC6)C5)CC4)CC3)c2)=C1 |
| InChI | InChI=1S/C45H53N/c1-3-11-32(12-4-1)39-28-40(33-13-5-2-6-14-33)30-41(29-39)34-20-22-35(23-21-34)42-24-25-43(45-19-8-7-18-44(42)45)37-16-9-15-36(27-37)38-17-10-26-46-31-38/h1,3,5,7,9,11,13,15-16,18,22,28-30,33-34,36,38,46H,2,4,6,8,10,12,14,17,19-21,23-27,31H2 |
| InChIKey | IVZSLAMKKHLRND-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.93 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|