C17H13ClFNO5 — CID 88536419
[3-acetyl-5-chloro-2-(3-fluorophenyl)-6-methylphenyl]-carboxycarbamic acid (PubChem CID 88536419) has the molecular formula C17H13ClFNO5 and a molecular weight of 365.74 g/mol. Its IUPAC name is [3-acetyl-5-chloro-2-(3-fluorophenyl)-6-methylphenyl]-carboxycarbamic acid.
| Compound Name | [3-acetyl-5-chloro-2-(3-fluorophenyl)-6-methylphenyl]-carboxycarbamic acid |
|---|---|
| PubChem CID | 88536419 |
| Molecular Formula | C17H13ClFNO5 |
| Molecular Weight | 365.74 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | [3-acetyl-5-chloro-2-(3-fluorophenyl)-6-methylphenyl]-carboxycarbamic acid |
| SMILES | CC(=O)c1cc(Cl)c(C)c(N(C(=O)O)C(=O)O)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C17H13ClFNO5/c1-8-13(18)7-12(9(2)21)14(10-4-3-5-11(19)6-10)15(8)20(16(22)23)17(24)25/h3-7H,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | KKACSVGFPZFBBS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.74 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |