C25H22N6O3 — CID 88536486
N-[[(3S,3aS)-6-[6-[(1R,5S)-3,6-dicyano-3-azabicyclo[3.1.0]hexan-6-yl]-3-pyridinyl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl]acetamide (PubChem CID 88536486) has the molecular formula C25H22N6O3 and a molecular weight of 454.49 g/mol. Its IUPAC name is N-[[(3S,3aS)-6-[6-[(1R,5S)-3,6-dicyano-3-azabicyclo[3.1.0]hexan-6-yl]-3-pyridinyl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl]acetamide.
| Compound Name | N-[[(3S,3aS)-6-[6-[(1R,5S)-3,6-dicyano-3-azabicyclo[3.1.0]hexan-6-yl]-3-pyridinyl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 88536486 |
| Molecular Formula | C25H22N6O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-[[(3S,3aS)-6-[6-[(1R,5S)-3,6-dicyano-3-azabicyclo[3.1.0]hexan-6-yl]-3-pyridinyl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@@H]1OC(=O)N2c3ccc(-c4ccc(C5(C#N)[C@@H]6CN(C#N)C[C@@H]65)nc4)cc3C[C@@H]12 |
| InChI | InChI=1S/C25H22N6O3/c1-14(32)28-9-22-21-7-17-6-15(2-4-20(17)31(21)24(33)34-22)16-3-5-23(29-8-16)25(12-26)18-10-30(13-27)11-19(18)25/h2-6,8,18-19,21-22H,7,9-11H2,1H3,(H,28,32)/t18-,19+,21-,22-,25?/m0/s1 |
| InChIKey | DDXWWMNFWJYTOM-VGRXHUQISA-N |
| XLogP | 1.94 |
| TPSA | 122.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|