C25H23N5O4 — CID 88542828
N-[[(3S,3aS)-6-[6-[(1R,5S)-3-formyl-6-isocyano-3-azabicyclo[3.1.0]hexan-6-yl]-3-pyridinyl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl]acetamide (PubChem CID 88542828) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-[[(3S,3aS)-6-[6-[(1R,5S)-3-formyl-6-isocyano-3-azabicyclo[3.1.0]hexan-6-yl]-3-pyridinyl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl]acetamide.
| Compound Name | N-[[(3S,3aS)-6-[6-[(1R,5S)-3-formyl-6-isocyano-3-azabicyclo[3.1.0]hexan-6-yl]-3-pyridinyl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 88542828 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-[[(3S,3aS)-6-[6-[(1R,5S)-3-formyl-6-isocyano-3-azabicyclo[3.1.0]hexan-6-yl]-3-pyridinyl]-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl]acetamide |
| SMILES | [C-]#[N+]C1(c2ccc(-c3ccc4c(c3)C[C@H]3[C@H](CNC(C)=O)OC(=O)N43)cn2)[C@@H]2CN(C=O)C[C@@H]21 |
| InChI | InChI=1S/C25H23N5O4/c1-14(32)27-10-22-21-8-17-7-15(3-5-20(17)30(21)24(33)34-22)16-4-6-23(28-9-16)25(26-2)18-11-29(13-31)12-19(18)25/h3-7,9,13,18-19,21-22H,8,10-12H2,1H3,(H,27,32)/t18-,19+,21-,22-,25?/m0/s1 |
| InChIKey | HNNHPTVFKBOCJC-VGRXHUQISA-N |
| XLogP | 1.97 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|