C15H28O3 — CID 88537299
(2,2-dimethyl-3-oxopropyl) decanoate (PubChem CID 88537299) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (2,2-dimethyl-3-oxopropyl) decanoate.
| Compound Name | (2,2-dimethyl-3-oxopropyl) decanoate |
|---|---|
| PubChem CID | 88537299 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (2,2-dimethyl-3-oxopropyl) decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(C)(C)C=O |
| InChI | InChI=1S/C15H28O3/c1-4-5-6-7-8-9-10-11-14(17)18-13-15(2,3)12-16/h12H,4-11,13H2,1-3H3 |
| InChIKey | YSKBYQIERGOBPX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|