C21H21F2NO4 — CID 8853745
2-[4-[(E)-3-(2,6-difluorophenyl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N,N-dimethylacetamide (PubChem CID 8853745) has the molecular formula C21H21F2NO4 and a molecular weight of 389.40 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2,6-difluorophenyl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[(E)-3-(2,6-difluorophenyl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 8853745 |
| Molecular Formula | C21H21F2NO4 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-[4-[(E)-3-(2,6-difluorophenyl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N,N-dimethylacetamide |
| SMILES | CCOc1cc(/C=C/C(=O)c2c(F)cccc2F)ccc1OCC(=O)N(C)C |
| InChI | InChI=1S/C21H21F2NO4/c1-4-27-19-12-14(9-11-18(19)28-13-20(26)24(2)3)8-10-17(25)21-15(22)6-5-7-16(21)23/h5-12H,4,13H2,1-3H3/b10-8+ |
| InChIKey | GCLAVCLKQWUSHJ-CSKARUKUSA-N |
| XLogP | 3.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|