C21H25Cl2NO3 — CID 88540529
benzyl N-[2-(2-tert-butyl-3,4-dichloro-6-methoxyphenyl)ethyl]carbamate (PubChem CID 88540529) has the molecular formula C21H25Cl2NO3 and a molecular weight of 410.34 g/mol. Its IUPAC name is benzyl N-[2-(2-tert-butyl-3,4-dichloro-6-methoxyphenyl)ethyl]carbamate.
| Compound Name | benzyl N-[2-(2-tert-butyl-3,4-dichloro-6-methoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 88540529 |
| Molecular Formula | C21H25Cl2NO3 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | benzyl N-[2-(2-tert-butyl-3,4-dichloro-6-methoxyphenyl)ethyl]carbamate |
| SMILES | COc1cc(Cl)c(Cl)c(C(C)(C)C)c1CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H25Cl2NO3/c1-21(2,3)18-15(17(26-4)12-16(22)19(18)23)10-11-24-20(25)27-13-14-8-6-5-7-9-14/h5-9,12H,10-11,13H2,1-4H3,(H,24,25) |
| InChIKey | YBGVTRINMWUYQI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |