C27H37N6O9P — CID 88542055
butoxy-[3-(4-carboxyoxypiperazin-1-yl)-2-[[6-[(3R)-3-hydroxypyrrolidin-1-yl]-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphinic acid (PubChem CID 88542055) has the molecular formula C27H37N6O9P and a molecular weight of 620.60 g/mol. Its IUPAC name is butoxy-[3-(4-carboxyoxypiperazin-1-yl)-2-[[6-[(3R)-3-hydroxypyrrolidin-1-yl]-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphinic acid.
| Compound Name | butoxy-[3-(4-carboxyoxypiperazin-1-yl)-2-[[6-[(3R)-3-hydroxypyrrolidin-1-yl]-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphinic acid |
|---|---|
| PubChem CID | 88542055 |
| Molecular Formula | C27H37N6O9P |
| Molecular Weight | 620.60 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | butoxy-[3-(4-carboxyoxypiperazin-1-yl)-2-[[6-[(3R)-3-hydroxypyrrolidin-1-yl]-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphinic acid |
| SMILES | CCCCOP(=O)(O)CC(NC(=O)c1cc(N2CC[C@@H](O)C2)nc(-c2ccccc2)n1)C(=O)N1CCN(OC(=O)O)CC1 |
| InChI | InChI=1S/C27H37N6O9P/c1-2-3-15-41-43(39,40)18-22(26(36)31-11-13-33(14-12-31)42-27(37)38)29-25(35)21-16-23(32-10-9-20(34)17-32)30-24(28-21)19-7-5-4-6-8-19/h4-8,16,20,22,34H,2-3,9-15,17-18H2,1H3,(H,29,35)(H,37,38)(H,39,40)/t20-,22?/m1/s1 |
| InChIKey | XEEDPBZXFNWNGJ-PSDZMVHGSA-N |
| XLogP | 1.57 |
| TPSA | 194.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.60 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|