C25H34N5O10P — CID 88541954
butoxy-[(2R)-3-(4-carboxyoxypiperazin-1-yl)-2-[[6-(2-hydroxyethoxy)-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphinic acid (PubChem CID 88541954) has the molecular formula C25H34N5O10P and a molecular weight of 595.55 g/mol. Its IUPAC name is butoxy-[(2R)-3-(4-carboxyoxypiperazin-1-yl)-2-[[6-(2-hydroxyethoxy)-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphinic acid.
| Compound Name | butoxy-[(2R)-3-(4-carboxyoxypiperazin-1-yl)-2-[[6-(2-hydroxyethoxy)-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphinic acid |
|---|---|
| PubChem CID | 88541954 |
| Molecular Formula | C25H34N5O10P |
| Molecular Weight | 595.55 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | butoxy-[(2R)-3-(4-carboxyoxypiperazin-1-yl)-2-[[6-(2-hydroxyethoxy)-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphinic acid |
| SMILES | CCCCOP(=O)(O)C[C@H](NC(=O)c1cc(OCCO)nc(-c2ccccc2)n1)C(=O)N1CCN(OC(=O)O)CC1 |
| InChI | InChI=1S/C25H34N5O10P/c1-2-3-14-39-41(36,37)17-20(24(33)29-9-11-30(12-10-29)40-25(34)35)27-23(32)19-16-21(38-15-13-31)28-22(26-19)18-7-5-4-6-8-18/h4-8,16,20,31H,2-3,9-15,17H2,1H3,(H,27,32)(H,34,35)(H,36,37)/t20-/m0/s1 |
| InChIKey | GSGOQGBYDFYVPZ-FQEVSTJZSA-N |
| XLogP | 1.37 |
| TPSA | 200.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.55 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|