C28H40N5O8P — CID 152671768
[(2R)-7-(4-butoxycarbonylpiperazin-1-yl)-2-[(6-methoxy-2-phenylpyrimidine-4-carbonyl)amino]-3-oxoheptyl]phosphonic acid (PubChem CID 152671768) has the molecular formula C28H40N5O8P and a molecular weight of 605.63 g/mol. Its IUPAC name is [(2R)-7-(4-butoxycarbonylpiperazin-1-yl)-2-[(6-methoxy-2-phenylpyrimidine-4-carbonyl)amino]-3-oxoheptyl]phosphonic acid.
| Compound Name | [(2R)-7-(4-butoxycarbonylpiperazin-1-yl)-2-[(6-methoxy-2-phenylpyrimidine-4-carbonyl)amino]-3-oxoheptyl]phosphonic acid |
|---|---|
| PubChem CID | 152671768 |
| Molecular Formula | C28H40N5O8P |
| Molecular Weight | 605.63 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | [(2R)-7-(4-butoxycarbonylpiperazin-1-yl)-2-[(6-methoxy-2-phenylpyrimidine-4-carbonyl)amino]-3-oxoheptyl]phosphonic acid |
| SMILES | CCCCOC(=O)N1CCN(CCCCC(=O)[C@H](CP(=O)(O)O)NC(=O)c2cc(OC)nc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C28H40N5O8P/c1-3-4-18-41-28(36)33-16-14-32(15-17-33)13-9-8-12-24(34)23(20-42(37,38)39)30-27(35)22-19-25(40-2)31-26(29-22)21-10-6-5-7-11-21/h5-7,10-11,19,23H,3-4,8-9,12-18,20H2,1-2H3,(H,30,35)(H2,37,38,39)/t23-/m0/s1 |
| InChIKey | ZLRQVWJVGQXZGC-QHCPKHFHSA-N |
| XLogP | 2.72 |
| TPSA | 171.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.63 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|