C27H37N4O7P — CID 66940149
[3-(4-butoxycarbonylpiperazin-1-yl)-3-oxo-2-[(6-phenyl-4-propan-2-ylpyridine-2-carbonyl)amino]propyl]phosphonic acid (PubChem CID 66940149) has the molecular formula C27H37N4O7P and a molecular weight of 560.59 g/mol. Its IUPAC name is [3-(4-butoxycarbonylpiperazin-1-yl)-3-oxo-2-[(6-phenyl-4-propan-2-ylpyridine-2-carbonyl)amino]propyl]phosphonic acid.
| Compound Name | [3-(4-butoxycarbonylpiperazin-1-yl)-3-oxo-2-[(6-phenyl-4-propan-2-ylpyridine-2-carbonyl)amino]propyl]phosphonic acid |
|---|---|
| PubChem CID | 66940149 |
| Molecular Formula | C27H37N4O7P |
| Molecular Weight | 560.59 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | [3-(4-butoxycarbonylpiperazin-1-yl)-3-oxo-2-[(6-phenyl-4-propan-2-ylpyridine-2-carbonyl)amino]propyl]phosphonic acid |
| SMILES | CCCCOC(=O)N1CCN(C(=O)C(CP(=O)(O)O)NC(=O)c2cc(C(C)C)cc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C27H37N4O7P/c1-4-5-15-38-27(34)31-13-11-30(12-14-31)26(33)24(18-39(35,36)37)29-25(32)23-17-21(19(2)3)16-22(28-23)20-9-7-6-8-10-20/h6-10,16-17,19,24H,4-5,11-15,18H2,1-3H3,(H,29,32)(H2,35,36,37) |
| InChIKey | YGOWXNOKGDGHIL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 149.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|