C35H42F3N4O7P — CID 87200341
butyl 4-[(2R)-3-diethoxyphosphoryl-2-[[4-phenyl-6-[3-(trifluoromethyl)phenyl]pyridine-2-carbonyl]amino]propanoyl]piperazine-1-carboxylate (PubChem CID 87200341) has the molecular formula C35H42F3N4O7P and a molecular weight of 718.71 g/mol. Its IUPAC name is butyl 4-[(2R)-3-diethoxyphosphoryl-2-[[4-phenyl-6-[3-(trifluoromethyl)phenyl]pyridine-2-carbonyl]amino]propanoyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[(2R)-3-diethoxyphosphoryl-2-[[4-phenyl-6-[3-(trifluoromethyl)phenyl]pyridine-2-carbonyl]amino]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87200341 |
| Molecular Formula | C35H42F3N4O7P |
| Molecular Weight | 718.71 g/mol |
| Exact Mass | 718.27 |
| IUPAC Name | butyl 4-[(2R)-3-diethoxyphosphoryl-2-[[4-phenyl-6-[3-(trifluoromethyl)phenyl]pyridine-2-carbonyl]amino]propanoyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)[C@H](CP(=O)(OCC)OCC)NC(=O)c2cc(-c3ccccc3)cc(-c3cccc(C(F)(F)F)c3)n2)CC1 |
| InChI | InChI=1S/C35H42F3N4O7P/c1-4-7-20-47-34(45)42-18-16-41(17-19-42)33(44)31(24-50(46,48-5-2)49-6-3)40-32(43)30-23-27(25-12-9-8-10-13-25)22-29(39-30)26-14-11-15-28(21-26)35(36,37)38/h8-15,21-23,31H,4-7,16-20,24H2,1-3H3,(H,40,43)/t31-/m0/s1 |
| InChIKey | HHPWHBCNORQYDM-HKBQPEDESA-N |
| XLogP | 6.88 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.71 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|