C33H48N5O8P — CID 87211926
butyl 4-[3-diethoxyphosphoryl-2-[[4-(3-methoxypyrrolidin-1-yl)-6-phenylpyridine-2-carbonyl]amino]propanoyl]piperazine-1-carboxylate (PubChem CID 87211926) has the molecular formula C33H48N5O8P and a molecular weight of 673.75 g/mol. Its IUPAC name is butyl 4-[3-diethoxyphosphoryl-2-[[4-(3-methoxypyrrolidin-1-yl)-6-phenylpyridine-2-carbonyl]amino]propanoyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[3-diethoxyphosphoryl-2-[[4-(3-methoxypyrrolidin-1-yl)-6-phenylpyridine-2-carbonyl]amino]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87211926 |
| Molecular Formula | C33H48N5O8P |
| Molecular Weight | 673.75 g/mol |
| Exact Mass | 673.32 |
| IUPAC Name | butyl 4-[3-diethoxyphosphoryl-2-[[4-(3-methoxypyrrolidin-1-yl)-6-phenylpyridine-2-carbonyl]amino]propanoyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)C(CP(=O)(OCC)OCC)NC(=O)c2cc(N3CCC(OC)C3)cc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C33H48N5O8P/c1-5-8-20-44-33(41)37-18-16-36(17-19-37)32(40)30(24-47(42,45-6-2)46-7-3)35-31(39)29-22-26(38-15-14-27(23-38)43-4)21-28(34-29)25-12-10-9-11-13-25/h9-13,21-22,27,30H,5-8,14-20,23-24H2,1-4H3,(H,35,39) |
| InChIKey | CEAXVQAFYQEJLO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.75 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|