C32H39N4O7P — CID 87200698
ethyl 4-[(2R)-3-diethoxyphosphoryl-2-[(4,6-diphenylpyridine-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate (PubChem CID 87200698) has the molecular formula C32H39N4O7P and a molecular weight of 622.66 g/mol. Its IUPAC name is ethyl 4-[(2R)-3-diethoxyphosphoryl-2-[(4,6-diphenylpyridine-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(2R)-3-diethoxyphosphoryl-2-[(4,6-diphenylpyridine-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87200698 |
| Molecular Formula | C32H39N4O7P |
| Molecular Weight | 622.66 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | ethyl 4-[(2R)-3-diethoxyphosphoryl-2-[(4,6-diphenylpyridine-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)[C@H](CP(=O)(OCC)OCC)NC(=O)c2cc(-c3ccccc3)cc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C32H39N4O7P/c1-4-41-32(39)36-19-17-35(18-20-36)31(38)29(23-44(40,42-5-2)43-6-3)34-30(37)28-22-26(24-13-9-7-10-14-24)21-27(33-28)25-15-11-8-12-16-25/h7-16,21-22,29H,4-6,17-20,23H2,1-3H3,(H,34,37)/t29-/m0/s1 |
| InChIKey | GCQUHZISIUWAAY-LJAQVGFWSA-N |
| XLogP | 5.08 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|