C31H46N5O7P — CID 87473496
butyl 4-[(2R)-2-[(6-butyl-2-phenylpyrimidine-4-carbonyl)amino]-3-diethoxyphosphorylpropanoyl]piperazine-1-carboxylate (PubChem CID 87473496) has the molecular formula C31H46N5O7P and a molecular weight of 631.71 g/mol. Its IUPAC name is butyl 4-[(2R)-2-[(6-butyl-2-phenylpyrimidine-4-carbonyl)amino]-3-diethoxyphosphorylpropanoyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[(2R)-2-[(6-butyl-2-phenylpyrimidine-4-carbonyl)amino]-3-diethoxyphosphorylpropanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87473496 |
| Molecular Formula | C31H46N5O7P |
| Molecular Weight | 631.71 g/mol |
| Exact Mass | 631.31 |
| IUPAC Name | butyl 4-[(2R)-2-[(6-butyl-2-phenylpyrimidine-4-carbonyl)amino]-3-diethoxyphosphorylpropanoyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)[C@H](CP(=O)(OCC)OCC)NC(=O)c2cc(CCCC)nc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C31H46N5O7P/c1-5-9-16-25-22-26(33-28(32-25)24-14-12-11-13-15-24)29(37)34-27(23-44(40,42-7-3)43-8-4)30(38)35-17-19-36(20-18-35)31(39)41-21-10-6-2/h11-15,22,27H,5-10,16-21,23H2,1-4H3,(H,34,37)/t27-/m0/s1 |
| InChIKey | WRFOAPSMKBHDIJ-MHZLTWQESA-N |
| XLogP | 4.93 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.71 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|