C25H32ClN5O4 — CID 87120301
butyl 4-[2-[(6-chloro-2-phenylpyrimidine-4-carbonyl)amino]-3-methylbutanoyl]piperazine-1-carboxylate (PubChem CID 87120301) has the molecular formula C25H32ClN5O4 and a molecular weight of 502.02 g/mol. Its IUPAC name is butyl 4-[2-[(6-chloro-2-phenylpyrimidine-4-carbonyl)amino]-3-methylbutanoyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[2-[(6-chloro-2-phenylpyrimidine-4-carbonyl)amino]-3-methylbutanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87120301 |
| Molecular Formula | C25H32ClN5O4 |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | butyl 4-[2-[(6-chloro-2-phenylpyrimidine-4-carbonyl)amino]-3-methylbutanoyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)C(NC(=O)c2cc(Cl)nc(-c3ccccc3)n2)C(C)C)CC1 |
| InChI | InChI=1S/C25H32ClN5O4/c1-4-5-15-35-25(34)31-13-11-30(12-14-31)24(33)21(17(2)3)29-23(32)19-16-20(26)28-22(27-19)18-9-7-6-8-10-18/h6-10,16-17,21H,4-5,11-15H2,1-3H3,(H,29,32) |
| InChIKey | PRKKPMGILUMYIR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|