C28H38N5O8P — CID 42630489
[(2R)-3-(4-butoxycarbonylpiperazin-1-yl)-2-[[6-[(1S,2S)-2-(methoxymethyl)cyclopropyl]-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphonic acid (PubChem CID 42630489) has the molecular formula C28H38N5O8P and a molecular weight of 603.61 g/mol. Its IUPAC name is [(2R)-3-(4-butoxycarbonylpiperazin-1-yl)-2-[[6-[(1S,2S)-2-(methoxymethyl)cyclopropyl]-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphonic acid.
| Compound Name | [(2R)-3-(4-butoxycarbonylpiperazin-1-yl)-2-[[6-[(1S,2S)-2-(methoxymethyl)cyclopropyl]-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphonic acid |
|---|---|
| PubChem CID | 42630489 |
| Molecular Formula | C28H38N5O8P |
| Molecular Weight | 603.61 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | [(2R)-3-(4-butoxycarbonylpiperazin-1-yl)-2-[[6-[(1S,2S)-2-(methoxymethyl)cyclopropyl]-2-phenylpyrimidine-4-carbonyl]amino]-3-oxopropyl]phosphonic acid |
| SMILES | CCCCOC(=O)N1CCN(C(=O)[C@H](CP(=O)(O)O)NC(=O)c2cc([C@H]3C[C@@H]3COC)nc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C28H38N5O8P/c1-3-4-14-41-28(36)33-12-10-32(11-13-33)27(35)24(18-42(37,38)39)31-26(34)23-16-22(21-15-20(21)17-40-2)29-25(30-23)19-8-6-5-7-9-19/h5-9,16,20-21,24H,3-4,10-15,17-18H2,1-2H3,(H,31,34)(H2,37,38,39)/t20-,21+,24+/m1/s1 |
| InChIKey | FAIKKQYAHATSDJ-DPLHUUCSSA-N |
| XLogP | 2.25 |
| TPSA | 171.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.61 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|