C27H34N5O6P — CID 141235632
butyl 4-[(2R)-2-[[6-(3-hydroxybutyl)-2-phenylpyrimidine-4-carbonyl]amino]-3-(oxo-λ5-phosphanylidyne)propanoyl]piperazine-1-carboxylate (PubChem CID 141235632) has the molecular formula C27H34N5O6P and a molecular weight of 555.57 g/mol. Its IUPAC name is butyl 4-[(2R)-2-[[6-(3-hydroxybutyl)-2-phenylpyrimidine-4-carbonyl]amino]-3-(oxo-λ5-phosphanylidyne)propanoyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[(2R)-2-[[6-(3-hydroxybutyl)-2-phenylpyrimidine-4-carbonyl]amino]-3-(oxo-λ5-phosphanylidyne)propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141235632 |
| Molecular Formula | C27H34N5O6P |
| Molecular Weight | 555.57 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | butyl 4-[(2R)-2-[[6-(3-hydroxybutyl)-2-phenylpyrimidine-4-carbonyl]amino]-3-(oxo-λ5-phosphanylidyne)propanoyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)[C@H](C#P=O)NC(=O)c2cc(CCC(C)O)nc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C27H34N5O6P/c1-3-4-16-38-27(36)32-14-12-31(13-15-32)26(35)23(18-39-37)30-25(34)22-17-21(11-10-19(2)33)28-24(29-22)20-8-6-5-7-9-20/h5-9,17,19,23,33H,3-4,10-16H2,1-2H3,(H,30,34)/t19?,23-/m0/s1 |
| InChIKey | RJXNXSGMYDIVLP-BVHINDKJSA-N |
| XLogP | 2.89 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.57 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|